C22H30F3N7O3S — CID 146527246
5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]-N-(2-methylpropyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 146527246) has the molecular formula C22H30F3N7O3S and a molecular weight of 529.59 g/mol. Its IUPAC name is 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]-N-(2-methylpropyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]-N-(2-methylpropyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 146527246 |
| Molecular Formula | C22H30F3N7O3S |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]-N-(2-methylpropyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CC(C)CNC(=O)c1nnc(CCCCN(N)/C=C(\N)C(=O)NCc2cccc(OC(F)(F)F)c2)s1 |
| InChI | InChI=1S/C22H30F3N7O3S/c1-14(2)11-28-20(34)21-31-30-18(36-21)8-3-4-9-32(27)13-17(26)19(33)29-12-15-6-5-7-16(10-15)35-22(23,24)25/h5-7,10,13-14H,3-4,8-9,11-12,26-27H2,1-2H3,(H,28,34)(H,29,33)/b17-13- |
| InChIKey | BEKLOADSXDLYFZ-LGMDPLHJSA-N |
| XLogP | 2.44 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|