C25H29F4N9O3 — CID 146527252
1-[4-[amino-[(Z)-2-amino-3-[[3-(fluoromethoxy)phenyl]methylamino]-3-oxoprop-1-enyl]amino]butyl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]triazole-4-carboxamide (PubChem CID 146527252) has the molecular formula C25H29F4N9O3 and a molecular weight of 579.56 g/mol. Its IUPAC name is 1-[4-[amino-[(Z)-2-amino-3-[[3-(fluoromethoxy)phenyl]methylamino]-3-oxoprop-1-enyl]amino]butyl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[amino-[(Z)-2-amino-3-[[3-(fluoromethoxy)phenyl]methylamino]-3-oxoprop-1-enyl]amino]butyl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 146527252 |
| Molecular Formula | C25H29F4N9O3 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 1-[4-[amino-[(Z)-2-amino-3-[[3-(fluoromethoxy)phenyl]methylamino]-3-oxoprop-1-enyl]amino]butyl]-N-[[5-(trifluoromethyl)-3-pyridinyl]methyl]triazole-4-carboxamide |
| SMILES | N/C(=C\N(N)CCCCn1cc(C(=O)NCc2cncc(C(F)(F)F)c2)nn1)C(=O)NCc1cccc(OCF)c1 |
| InChI | InChI=1S/C25H29F4N9O3/c26-16-41-20-5-3-4-17(9-20)11-33-23(39)21(30)14-37(31)6-1-2-7-38-15-22(35-36-38)24(40)34-12-18-8-19(13-32-10-18)25(27,28)29/h3-5,8-10,13-15H,1-2,6-7,11-12,16,30-31H2,(H,33,39)(H,34,40)/b21-14- |
| InChIKey | VXAHOIXQMKYMJX-STZFKDTASA-N |
| XLogP | 2.00 |
| TPSA | 166.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|