C18H22F3N7O3 — CID 144992744
1-[4-[[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]triazole-4-carboxamide (PubChem CID 144992744) has the molecular formula C18H22F3N7O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[4-[[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 144992744 |
| Molecular Formula | C18H22F3N7O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[4-[[(Z)-2-amino-3-oxo-3-[[3-(trifluoromethoxy)phenyl]methylamino]prop-1-enyl]amino]butyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CCCCN/C=C(\N)C(=O)NCc2cccc(OC(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C18H22F3N7O3/c19-18(20,21)31-13-5-3-4-12(8-13)9-25-17(30)14(22)10-24-6-1-2-7-28-11-15(16(23)29)26-27-28/h3-5,8,10-11,24H,1-2,6-7,9,22H2,(H2,23,29)(H,25,30)/b14-10- |
| InChIKey | DGEUBSGUFBLIKG-UVTDQMKNSA-N |
| XLogP | 0.76 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|