C22H21F3N4O4 — CID 118627238
4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl benzoate (PubChem CID 118627238) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl benzoate.
| Compound Name | 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl benzoate |
|---|---|
| PubChem CID | 118627238 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl benzoate |
| SMILES | O=C(OCCCCn1cc(C(=O)NCc2cccc(OC(F)(F)F)c2)nn1)c1ccccc1 |
| InChI | InChI=1S/C22H21F3N4O4/c23-22(24,25)33-18-10-6-7-16(13-18)14-26-20(30)19-15-29(28-27-19)11-4-5-12-32-21(31)17-8-2-1-3-9-17/h1-3,6-10,13,15H,4-5,11-12,14H2,(H,26,30) |
| InChIKey | STVPUXGKCHWAOJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|