C27H26F3N7O4 — CID 118626209
N-benzyl-1-[4-[2-oxo-6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1H-pyrimidin-5-yl]butyl]triazole-4-carboxamide (PubChem CID 118626209) has the molecular formula C27H26F3N7O4 and a molecular weight of 569.54 g/mol. Its IUPAC name is N-benzyl-1-[4-[2-oxo-6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1H-pyrimidin-5-yl]butyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[4-[2-oxo-6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1H-pyrimidin-5-yl]butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 118626209 |
| Molecular Formula | C27H26F3N7O4 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | N-benzyl-1-[4-[2-oxo-6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1H-pyrimidin-5-yl]butyl]triazole-4-carboxamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1[nH]c(=O)ncc1CCCCn1cc(C(=O)NCc2ccccc2)nn1 |
| InChI | InChI=1S/C27H26F3N7O4/c28-27(29,30)41-21-11-6-9-19(13-21)14-23(38)33-24-20(16-32-26(40)34-24)10-4-5-12-37-17-22(35-36-37)25(39)31-15-18-7-2-1-3-8-18/h1-3,6-9,11,13,16-17H,4-5,10,12,14-15H2,(H,31,39)(H2,32,33,34,38,40) |
| InChIKey | ZNTAVWNXRXHTMT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|