C18H20F3N7O3 — CID 154982545
1-[4-[4-(hydroxymethyl)triazol-1-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide (PubChem CID 154982545) has the molecular formula C18H20F3N7O3 and a molecular weight of 439.40 g/mol. Its IUPAC name is 1-[4-[4-(hydroxymethyl)triazol-1-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[4-(hydroxymethyl)triazol-1-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 154982545 |
| Molecular Formula | C18H20F3N7O3 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[4-[4-(hydroxymethyl)triazol-1-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)c1cn(CCCCn2cc(CO)nn2)nn1 |
| InChI | InChI=1S/C18H20F3N7O3/c19-18(20,21)31-15-5-3-4-13(8-15)9-22-17(30)16-11-28(26-24-16)7-2-1-6-27-10-14(12-29)23-25-27/h3-5,8,10-11,29H,1-2,6-7,9,12H2,(H,22,30) |
| InChIKey | TVCNMPLGIPORMH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|