C13H15F2N5O2 — CID 70763522
1-(2-aminoethyl)-N-[[3-(difluoromethoxy)phenyl]methyl]triazole-4-carboxamide (PubChem CID 70763522) has the molecular formula C13H15F2N5O2 and a molecular weight of 311.29 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[[3-(difluoromethoxy)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[[3-(difluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 70763522 |
| Molecular Formula | C13H15F2N5O2 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(2-aminoethyl)-N-[[3-(difluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
| SMILES | NCCn1cc(C(=O)NCc2cccc(OC(F)F)c2)nn1 |
| InChI | InChI=1S/C13H15F2N5O2/c14-13(15)22-10-3-1-2-9(6-10)7-17-12(21)11-8-20(5-4-16)19-18-11/h1-3,6,8,13H,4-5,7,16H2,(H,17,21) |
| InChIKey | VWKWHBNNMRQXTB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |