C12H13FN4O — CID 59757295
N-benzyl-1-(2-(18F)fluoroethyl)triazole-4-carboxamide (PubChem CID 59757295) has the molecular formula C12H13FN4O and a molecular weight of 247.26 g/mol. Its IUPAC name is N-benzyl-1-(2-(18F)fluoroethyl)triazole-4-carboxamide.
| Compound Name | N-benzyl-1-(2-(18F)fluoroethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 59757295 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-benzyl-1-(2-(18F)fluoroethyl)triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cn(CC[18F])nn1 |
| InChI | InChI=1S/C12H13FN4O/c13-6-7-17-9-11(15-16-17)12(18)14-8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,14,18)/i13-1 |
| InChIKey | ZANHBBVTZWPMRT-HSGWXFLFSA-N |
| XLogP | 1.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |