C24H25F3N4O5 — CID 131999319
4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl 3-(methoxymethyl)benzoate (PubChem CID 131999319) has the molecular formula C24H25F3N4O5 and a molecular weight of 506.48 g/mol. Its IUPAC name is 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl 3-(methoxymethyl)benzoate.
| Compound Name | 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 131999319 |
| Molecular Formula | C24H25F3N4O5 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[4-[[3-(trifluoromethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl 3-(methoxymethyl)benzoate |
| SMILES | COCc1cccc(C(=O)OCCCCn2cc(C(=O)NCc3cccc(OC(F)(F)F)c3)nn2)c1 |
| InChI | InChI=1S/C24H25F3N4O5/c1-34-16-18-7-4-8-19(12-18)23(33)35-11-3-2-10-31-15-21(29-30-31)22(32)28-14-17-6-5-9-20(13-17)36-24(25,26)27/h4-9,12-13,15H,2-3,10-11,14,16H2,1H3,(H,28,32) |
| InChIKey | FZYNZKKVSMWRGS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|