C24H32FIN8O4 — CID 146527248
2-methylpropyl N-[[1-[4-[4-[[3-(1-fluoro-1-iodoethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl]triazol-4-yl]methyl]carbamate (PubChem CID 146527248) has the molecular formula C24H32FIN8O4 and a molecular weight of 642.47 g/mol. Its IUPAC name is 2-methylpropyl N-[[1-[4-[4-[[3-(1-fluoro-1-iodoethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl]triazol-4-yl]methyl]carbamate.
| Compound Name | 2-methylpropyl N-[[1-[4-[4-[[3-(1-fluoro-1-iodoethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl]triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 146527248 |
| Molecular Formula | C24H32FIN8O4 |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 2-methylpropyl N-[[1-[4-[4-[[3-(1-fluoro-1-iodoethoxy)phenyl]methylcarbamoyl]triazol-1-yl]butyl]triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)COC(=O)NCc1cn(CCCCn2cc(C(=O)NCc3cccc(OC(C)(F)I)c3)nn2)nn1 |
| InChI | InChI=1S/C24H32FIN8O4/c1-17(2)16-37-23(36)28-13-19-14-33(31-29-19)9-4-5-10-34-15-21(30-32-34)22(35)27-12-18-7-6-8-20(11-18)38-24(3,25)26/h6-8,11,14-15,17H,4-5,9-10,12-13,16H2,1-3H3,(H,27,35)(H,28,36) |
| InChIKey | RWAJVQTWMFXSQK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|