C26H29F3IN9O3 — CID 146527007
1-[4-[4-[[3-(iodomethoxy)phenyl]methylcarbamoyl]-3-methyl-2H-triazol-1-yl]butyl]-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]triazole-4-carboxamide (PubChem CID 146527007) has the molecular formula C26H29F3IN9O3 and a molecular weight of 699.48 g/mol. Its IUPAC name is 1-[4-[4-[[3-(iodomethoxy)phenyl]methylcarbamoyl]-3-methyl-2H-triazol-1-yl]butyl]-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[4-[[3-(iodomethoxy)phenyl]methylcarbamoyl]-3-methyl-2H-triazol-1-yl]butyl]-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 146527007 |
| Molecular Formula | C26H29F3IN9O3 |
| Molecular Weight | 699.48 g/mol |
| Exact Mass | 699.14 |
| IUPAC Name | 1-[4-[4-[[3-(iodomethoxy)phenyl]methylcarbamoyl]-3-methyl-2H-triazol-1-yl]butyl]-N-[[2-(trifluoromethyl)-4-pyridinyl]methyl]triazole-4-carboxamide |
| SMILES | CN1NN(CCCCn2cc(C(=O)NCc3ccnc(C(F)(F)F)c3)nn2)C=C1C(=O)NCc1cccc(OCI)c1 |
| InChI | InChI=1S/C26H29F3IN9O3/c1-37-22(25(41)33-13-18-5-4-6-20(11-18)42-17-30)16-39(36-37)10-3-2-9-38-15-21(34-35-38)24(40)32-14-19-7-8-31-23(12-19)26(27,28)29/h4-8,11-12,15-16,36H,2-3,9-10,13-14,17H2,1H3,(H,32,40)(H,33,41) |
| InChIKey | OKBQNQKNMFJPCW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|