C24H27F4N9O3 — CID 144992847
1-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]-3-fluorobutyl]-N-[(3-hydroxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 144992847) has the molecular formula C24H27F4N9O3 and a molecular weight of 565.53 g/mol. Its IUPAC name is 1-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]-3-fluorobutyl]-N-[(3-hydroxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]-3-fluorobutyl]-N-[(3-hydroxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 144992847 |
| Molecular Formula | C24H27F4N9O3 |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 1-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]-3-fluorobutyl]-N-[(3-hydroxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | N/C(=C\N(N)CC(F)CCn1cc(C(=O)NCc2cccc(O)c2)nn1)C(=O)NCc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C24H27F4N9O3/c25-17(5-7-37-14-21(34-35-37)23(40)32-10-15-2-1-3-19(38)8-15)12-36(30)13-20(29)22(39)33-11-18-9-16(4-6-31-18)24(26,27)28/h1-4,6,8-9,13-14,17,38H,5,7,10-12,29-30H2,(H,32,40)(H,33,39)/b20-13- |
| InChIKey | WHMIWRNIARGKHX-MOSHPQCFSA-N |
| XLogP | 1.35 |
| TPSA | 177.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|