C17H21F4N7O — CID 146527789
1-[4-[amino-[(E)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-1-enyl]amino]-3-fluorobutyl]-N-methyltriazole-4-carboxamide (PubChem CID 146527789) has the molecular formula C17H21F4N7O and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-[4-[amino-[(E)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-1-enyl]amino]-3-fluorobutyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[4-[amino-[(E)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-1-enyl]amino]-3-fluorobutyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 146527789 |
| Molecular Formula | C17H21F4N7O |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[4-[amino-[(E)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-1-enyl]amino]-3-fluorobutyl]-N-methyltriazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CCC(F)CN(N)/C=C/Cc2cc(C(F)(F)F)ccn2)nn1 |
| InChI | InChI=1S/C17H21F4N7O/c1-23-16(29)15-11-28(26-25-15)8-5-13(18)10-27(22)7-2-3-14-9-12(4-6-24-14)17(19,20)21/h2,4,6-7,9,11,13H,3,5,8,10,22H2,1H3,(H,23,29)/b7-2+ |
| InChIKey | AECWSFPWBWKZBM-FARCUNLSSA-N |
| XLogP | 1.71 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|