C18H23F3N8O2S — CID 146527352
5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]butyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 146527352) has the molecular formula C18H23F3N8O2S and a molecular weight of 472.50 g/mol. Its IUPAC name is 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]butyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]butyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 146527352 |
| Molecular Formula | C18H23F3N8O2S |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 5-[4-[amino-[(Z)-2-amino-3-oxo-3-[[4-(trifluoromethyl)-2-pyridinyl]methylamino]prop-1-enyl]amino]butyl]-N-methyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNC(=O)c1nnc(CCCCN(N)/C=C(\N)C(=O)NCc2cc(C(F)(F)F)ccn2)s1 |
| InChI | InChI=1S/C18H23F3N8O2S/c1-24-16(31)17-28-27-14(32-17)4-2-3-7-29(23)10-13(22)15(30)26-9-12-8-11(5-6-25-12)18(19,20)21/h5-6,8,10H,2-4,7,9,22-23H2,1H3,(H,24,31)(H,26,30)/b13-10- |
| InChIKey | UAMYDTPLNIZCQS-RAXLEYEMSA-N |
| XLogP | 0.93 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|