C18H20F4N8O2S — CID 163576865
5-[3-fluoro-4-[[2-hydrazinylidene-3-(methylamino)-3-oxopropylidene]amino]butyl]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 163576865) has the molecular formula C18H20F4N8O2S and a molecular weight of 488.47 g/mol. Its IUPAC name is 5-[3-fluoro-4-[[2-hydrazinylidene-3-(methylamino)-3-oxopropylidene]amino]butyl]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[3-fluoro-4-[[2-hydrazinylidene-3-(methylamino)-3-oxopropylidene]amino]butyl]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 163576865 |
| Molecular Formula | C18H20F4N8O2S |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 5-[3-fluoro-4-[[2-hydrazinylidene-3-(methylamino)-3-oxopropylidene]amino]butyl]-N-[[4-(trifluoromethyl)-2-pyridinyl]methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNC(=O)C(/C=N/CC(F)CCc1nnc(C(=O)NCc2cc(C(F)(F)F)ccn2)s1)=NN |
| InChI | InChI=1S/C18H20F4N8O2S/c1-24-15(31)13(28-23)9-25-7-11(19)2-3-14-29-30-17(33-14)16(32)27-8-12-6-10(4-5-26-12)18(20,21)22/h4-6,9,11H,2-3,7-8,23H2,1H3,(H,24,31)(H,27,32)/b25-9+,28-13? |
| InChIKey | QRZIQRQGTAVYBH-QIEYDABFSA-N |
| XLogP | 1.28 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|