C26H30N8O — CID 144992935
(Z)-2-amino-3-[amino-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]amino]-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 144992935) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]amino]-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]amino]-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 144992935 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]amino]-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | N/C(=C\N(N)CCCCc1cc2cc(Cc3ccccc3)[nH]c2nn1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C26H30N8O/c27-24(26(35)30-17-22-11-4-6-12-29-22)18-34(28)13-7-5-10-21-15-20-16-23(31-25(20)33-32-21)14-19-8-2-1-3-9-19/h1-4,6,8-9,11-12,15-16,18H,5,7,10,13-14,17,27-28H2,(H,30,35)(H,31,33)/b24-18- |
| InChIKey | CMVJHLLSDBQSMT-MOHJPFBDSA-N |
| XLogP | 2.56 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|