C19H20N8O — CID 118620879
N-(pyridin-2-ylmethyl)-1-[4-(7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxamide (PubChem CID 118620879) has the molecular formula C19H20N8O and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1-[4-(7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-1-[4-(7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 118620879 |
| Molecular Formula | C19H20N8O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1-[4-(7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cn(CCCCc2cc3cc[nH]c3nn2)nn1 |
| InChI | InChI=1S/C19H20N8O/c28-19(22-12-16-6-1-3-8-20-16)17-13-27(26-24-17)10-4-2-5-15-11-14-7-9-21-18(14)25-23-15/h1,3,6-9,11,13H,2,4-5,10,12H2,(H,21,25)(H,22,28) |
| InChIKey | IITCFLFFSRAKCU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|