C22H26N10O2 — CID 148527200
1-[4-[4-[(1-hydroxy-2-pyridin-2-ylethyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide (PubChem CID 148527200) has the molecular formula C22H26N10O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-[4-[4-[(1-hydroxy-2-pyridin-2-ylethyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-[4-[4-[(1-hydroxy-2-pyridin-2-ylethyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 148527200 |
| Molecular Formula | C22H26N10O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-[4-[4-[(1-hydroxy-2-pyridin-2-ylethyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cn(CCCCn2cc(NC(O)Cc3ccccn3)nn2)nn1 |
| InChI | InChI=1S/C22H26N10O2/c33-21(13-17-7-1-3-9-23-17)26-20-16-32(30-28-20)12-6-5-11-31-15-19(27-29-31)22(34)25-14-18-8-2-4-10-24-18/h1-4,7-10,15-16,21,26,33H,5-6,11-14H2,(H,25,34) |
| InChIKey | MPOLOURKUWUQBD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|