C22H29N9O2 — CID 118640748
1-[4-[4-[(2-cyclopentylacetyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide (PubChem CID 118640748) has the molecular formula C22H29N9O2 and a molecular weight of 451.54 g/mol. Its IUPAC name is 1-[4-[4-[(2-cyclopentylacetyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-[4-[4-[(2-cyclopentylacetyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 118640748 |
| Molecular Formula | C22H29N9O2 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[4-[4-[(2-cyclopentylacetyl)amino]triazol-1-yl]butyl]-N-(pyridin-2-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(CC1CCCC1)Nc1cn(CCCCn2cc(C(=O)NCc3ccccn3)nn2)nn1 |
| InChI | InChI=1S/C22H29N9O2/c32-21(13-17-7-1-2-8-17)25-20-16-31(29-27-20)12-6-5-11-30-15-19(26-28-30)22(33)24-14-18-9-3-4-10-23-18/h3-4,9-10,15-17H,1-2,5-8,11-14H2,(H,24,33)(H,25,32) |
| InChIKey | NEHXOPFBMUYAIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|