C24H35N9O2 — CID 144992924
1-[4-[4-[(2-cyclohexylacetyl)amino]triazol-1-yl]butyl]-3-methyl-N-(pyridin-3-ylmethyl)-2H-triazole-4-carboxamide (PubChem CID 144992924) has the molecular formula C24H35N9O2 and a molecular weight of 481.61 g/mol. Its IUPAC name is 1-[4-[4-[(2-cyclohexylacetyl)amino]triazol-1-yl]butyl]-3-methyl-N-(pyridin-3-ylmethyl)-2H-triazole-4-carboxamide.
| Compound Name | 1-[4-[4-[(2-cyclohexylacetyl)amino]triazol-1-yl]butyl]-3-methyl-N-(pyridin-3-ylmethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 144992924 |
| Molecular Formula | C24H35N9O2 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 1-[4-[4-[(2-cyclohexylacetyl)amino]triazol-1-yl]butyl]-3-methyl-N-(pyridin-3-ylmethyl)-2H-triazole-4-carboxamide |
| SMILES | CN1NN(CCCCn2cc(NC(=O)CC3CCCCC3)nn2)C=C1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C24H35N9O2/c1-31-21(24(35)26-16-20-10-7-11-25-15-20)17-33(30-31)13-6-5-12-32-18-22(28-29-32)27-23(34)14-19-8-3-2-4-9-19/h7,10-11,15,17-19,30H,2-6,8-9,12-14,16H2,1H3,(H,26,35)(H,27,34) |
| InChIKey | CVSMNRUZGBWNRO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|