C20H31N3O — CID 169215534
2-cyclohexyl-N-[4-(pyridin-3-ylmethylamino)cyclohexyl]acetamide (PubChem CID 169215534) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-cyclohexyl-N-[4-(pyridin-3-ylmethylamino)cyclohexyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[4-(pyridin-3-ylmethylamino)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 169215534 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 2-cyclohexyl-N-[4-(pyridin-3-ylmethylamino)cyclohexyl]acetamide |
| SMILES | O=C(CC1CCCCC1)NC1CCC(NCc2cccnc2)CC1 |
| InChI | InChI=1S/C20H31N3O/c24-20(13-16-5-2-1-3-6-16)23-19-10-8-18(9-11-19)22-15-17-7-4-12-21-14-17/h4,7,12,14,16,18-19,22H,1-3,5-6,8-11,13,15H2,(H,23,24) |
| InChIKey | MGMXRPQOBNOEPT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |