C24H30N6 — CID 177421480
1-N,3-N,5-N-tris(pyridin-3-ylmethyl)cyclohexane-1,3,5-triamine (PubChem CID 177421480) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(pyridin-3-ylmethyl)cyclohexane-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(pyridin-3-ylmethyl)cyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 177421480 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-N,3-N,5-N-tris(pyridin-3-ylmethyl)cyclohexane-1,3,5-triamine |
| SMILES | c1cncc(CNC2CC(NCc3cccnc3)CC(NCc3cccnc3)C2)c1 |
| InChI | InChI=1S/C24H30N6/c1-4-19(13-25-7-1)16-28-22-10-23(29-17-20-5-2-8-26-14-20)12-24(11-22)30-18-21-6-3-9-27-15-21/h1-9,13-15,22-24,28-30H,10-12,16-18H2 |
| InChIKey | YPPIMMKJRPKKPN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |