C16H17BrN2 — CID 43634519
3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)cyclobutan-1-amine (PubChem CID 43634519) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 43634519 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)cyclobutan-1-amine |
| SMILES | Brc1ccc(C2CC(NCc3cccnc3)C2)cc1 |
| InChI | InChI=1S/C16H17BrN2/c17-15-5-3-13(4-6-15)14-8-16(9-14)19-11-12-2-1-7-18-10-12/h1-7,10,14,16,19H,8-9,11H2 |
| InChIKey | MLWZRTNWTVSDMV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |