C17H19BrN2 — CID 62322840
3-(4-bromophenyl)-N-[(6-methyl-2-pyridinyl)methyl]cyclobutan-1-amine (PubChem CID 62322840) has the molecular formula C17H19BrN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(6-methyl-2-pyridinyl)methyl]cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-[(6-methyl-2-pyridinyl)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 62322840 |
| Molecular Formula | C17H19BrN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(6-methyl-2-pyridinyl)methyl]cyclobutan-1-amine |
| SMILES | Cc1cccc(CNC2CC(c3ccc(Br)cc3)C2)n1 |
| InChI | InChI=1S/C17H19BrN2/c1-12-3-2-4-16(20-12)11-19-17-9-14(10-17)13-5-7-15(18)8-6-13/h2-8,14,17,19H,9-11H2,1H3 |
| InChIKey | RKGIIEKKPIMXGM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |