C16H24BrN — CID 103460849
3-(4-bromophenyl)-N-(2,2-dimethylbutyl)cyclobutan-1-amine (PubChem CID 103460849) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(2,2-dimethylbutyl)cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-(2,2-dimethylbutyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 103460849 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-(4-bromophenyl)-N-(2,2-dimethylbutyl)cyclobutan-1-amine |
| SMILES | CCC(C)(C)CNC1CC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H24BrN/c1-4-16(2,3)11-18-15-9-13(10-15)12-5-7-14(17)8-6-12/h5-8,13,15,18H,4,9-11H2,1-3H3 |
| InChIKey | XEMJYJITXJSMEP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |