C16H24ClNO — CID 104530299
4-[[3-(4-chlorophenyl)cyclobutyl]amino]-3,3-dimethylbutan-1-ol (PubChem CID 104530299) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)cyclobutyl]amino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[[3-(4-chlorophenyl)cyclobutyl]amino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 104530299 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)cyclobutyl]amino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(CCO)CNC1CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H24ClNO/c1-16(2,7-8-19)11-18-15-9-13(10-15)12-3-5-14(17)6-4-12/h3-6,13,15,18-19H,7-11H2,1-2H3 |
| InChIKey | ZPPZNQJNWHHYCJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |