C10H16ClN3 — CID 71636735
(3R)-N-(pyridin-3-ylmethyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 71636735) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is (3R)-N-(pyridin-3-ylmethyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-N-(pyridin-3-ylmethyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71636735 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (3R)-N-(pyridin-3-ylmethyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.c1cncc(CN[C@@H]2CCNC2)c1 |
| InChI | InChI=1S/C10H15N3.ClH/c1-2-9(6-11-4-1)7-13-10-3-5-12-8-10;/h1-2,4,6,10,12-13H,3,5,7-8H2;1H/t10-;/m1./s1 |
| InChIKey | WHHQKXPHDMPWAW-HNCPQSOCSA-N |
| XLogP | 0.95 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |