C9H14N4 — CID 89348963
N-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 89348963) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is N-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine.
| Compound Name | N-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 89348963 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-(pyrimidin-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | c1cnc(CNC2CCNC2)nc1 |
| InChI | InChI=1S/C9H14N4/c1-3-11-9(12-4-1)7-13-8-2-5-10-6-8/h1,3-4,8,10,13H,2,5-7H2 |
| InChIKey | CQXQYOBGCBUCPH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |