C9H14Cl2N4 — CID 71640607
(3R)-N-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 71640607) has the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. Its IUPAC name is (3R)-N-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-N-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71640607 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (3R)-N-[(3-chloropyrazin-2-yl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.Clc1nccnc1CN[C@@H]1CCNC1 |
| InChI | InChI=1S/C9H13ClN4.ClH/c10-9-8(12-3-4-13-9)6-14-7-1-2-11-5-7;/h3-4,7,11,14H,1-2,5-6H2;1H/t7-;/m1./s1 |
| InChIKey | JOWFAFYDUHLABN-OGFXRTJISA-N |
| XLogP | 1.00 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |