C22H24N8O — CID 118621018
1-[4-(6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-N-(pyridin-4-ylmethyl)triazole-4-carboxamide (PubChem CID 118621018) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-[4-(6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-N-(pyridin-4-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-[4-(6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-N-(pyridin-4-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 118621018 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-[4-(6-cyclopropyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-N-(pyridin-4-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cn(CCCCc2cc3cc(C4CC4)[nH]c3nn2)nn1 |
| InChI | InChI=1S/C22H24N8O/c31-22(24-13-15-6-8-23-9-7-15)20-14-30(29-27-20)10-2-1-3-18-11-17-12-19(16-4-5-16)25-21(17)28-26-18/h6-9,11-12,14,16H,1-5,10,13H2,(H,24,31)(H,25,28) |
| InChIKey | GIBIKKBWJFKMGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|