C17H28N8O2 — CID 154982312
(Z)-2-amino-3-[amino-[4-[amino-[(Z)-2-amino-3-oxoprop-1-enyl]amino]butyl]amino]-N-[(6-methyl-3-pyridinyl)methyl]prop-2-enamide (PubChem CID 154982312) has the molecular formula C17H28N8O2 and a molecular weight of 376.47 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-[amino-[(Z)-2-amino-3-oxoprop-1-enyl]amino]butyl]amino]-N-[(6-methyl-3-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-[amino-[(Z)-2-amino-3-oxoprop-1-enyl]amino]butyl]amino]-N-[(6-methyl-3-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 154982312 |
| Molecular Formula | C17H28N8O2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-[amino-[(Z)-2-amino-3-oxoprop-1-enyl]amino]butyl]amino]-N-[(6-methyl-3-pyridinyl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(CNC(=O)/C(N)=C/N(N)CCCCN(N)/C=C(\N)C=O)cn1 |
| InChI | InChI=1S/C17H28N8O2/c1-13-4-5-14(8-22-13)9-23-17(27)16(19)11-25(21)7-3-2-6-24(20)10-15(18)12-26/h4-5,8,10-12H,2-3,6-7,9,18-21H2,1H3,(H,23,27)/b15-10-,16-11- |
| InChIKey | SCDCOWIWHBLMIP-XCMCHEKJSA-N |
| XLogP | -1.06 |
| TPSA | 169.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|