C12H16N4O4 — CID 63719043
(2S)-4-amino-2-[(6-methyl-3-pyridinyl)methylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 63719043) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-4-amino-2-[(6-methyl-3-pyridinyl)methylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(6-methyl-3-pyridinyl)methylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63719043 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2S)-4-amino-2-[(6-methyl-3-pyridinyl)methylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(CNC(=O)N[C@@H](CC(N)=O)C(=O)O)cn1 |
| InChI | InChI=1S/C12H16N4O4/c1-7-2-3-8(5-14-7)6-15-12(20)16-9(11(18)19)4-10(13)17/h2-3,5,9H,4,6H2,1H3,(H2,13,17)(H,18,19)(H2,15,16,20)/t9-/m0/s1 |
| InChIKey | KIVGMQDIFKEWCZ-VIFPVBQESA-N |
| XLogP | -0.48 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |