C17H27N9O — CID 154982358
1-[4-[amino-[(E)-2-amino-2-(methylamino)ethenyl]amino]butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide (PubChem CID 154982358) has the molecular formula C17H27N9O and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-[4-[amino-[(E)-2-amino-2-(methylamino)ethenyl]amino]butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[amino-[(E)-2-amino-2-(methylamino)ethenyl]amino]butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 154982358 |
| Molecular Formula | C17H27N9O |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 1-[4-[amino-[(E)-2-amino-2-(methylamino)ethenyl]amino]butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide |
| SMILES | CN/C(N)=C/N(N)CCCCn1cc(C(=O)NCc2ccc(C)nc2)nn1 |
| InChI | InChI=1S/C17H27N9O/c1-13-5-6-14(9-21-13)10-22-17(27)15-11-26(24-23-15)8-4-3-7-25(19)12-16(18)20-2/h5-6,9,11-12,20H,3-4,7-8,10,18-19H2,1-2H3,(H,22,27)/b16-12+ |
| InChIKey | YFUSOBCSQFUTEA-FOWTUZBSSA-N |
| XLogP | -0.16 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|