C17H19FN8O2 — CID 154982684
1-[3-fluoro-4-(4-formyltriazol-1-yl)butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide (PubChem CID 154982684) has the molecular formula C17H19FN8O2 and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-formyltriazol-1-yl)butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[3-fluoro-4-(4-formyltriazol-1-yl)butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 154982684 |
| Molecular Formula | C17H19FN8O2 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[3-fluoro-4-(4-formyltriazol-1-yl)butyl]-N-[(6-methyl-3-pyridinyl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cn(CCC(F)Cn3cc(C=O)nn3)nn2)cn1 |
| InChI | InChI=1S/C17H19FN8O2/c1-12-2-3-13(6-19-12)7-20-17(28)16-10-25(24-22-16)5-4-14(18)8-26-9-15(11-27)21-23-26/h2-3,6,9-11,14H,4-5,7-8H2,1H3,(H,20,28) |
| InChIKey | OGLYWUJSXWTCGX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|