C27H33N7O4 — CID 144993279
benzyl N-[1-[4-[amino-[(Z)-2-amino-3-[(6-methyl-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]amino]butyl]-2-oxo-4-pyridinyl]carbamate (PubChem CID 144993279) has the molecular formula C27H33N7O4 and a molecular weight of 519.61 g/mol. Its IUPAC name is benzyl N-[1-[4-[amino-[(Z)-2-amino-3-[(6-methyl-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]amino]butyl]-2-oxo-4-pyridinyl]carbamate.
| Compound Name | benzyl N-[1-[4-[amino-[(Z)-2-amino-3-[(6-methyl-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]amino]butyl]-2-oxo-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 144993279 |
| Molecular Formula | C27H33N7O4 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | benzyl N-[1-[4-[amino-[(Z)-2-amino-3-[(6-methyl-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]amino]butyl]-2-oxo-4-pyridinyl]carbamate |
| SMILES | Cc1ccc(CNC(=O)/C(N)=C/N(N)CCCCn2ccc(NC(=O)OCc3ccccc3)cc2=O)cn1 |
| InChI | InChI=1S/C27H33N7O4/c1-20-9-10-22(16-30-20)17-31-26(36)24(28)18-34(29)13-6-5-12-33-14-11-23(15-25(33)35)32-27(37)38-19-21-7-3-2-4-8-21/h2-4,7-11,14-16,18H,5-6,12-13,17,19,28-29H2,1H3,(H,31,36)(H,32,37)/b24-18- |
| InChIKey | AUQUEFMONOEFHZ-MOHJPFBDSA-N |
| XLogP | 2.37 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|