C20H21N5O4 — CID 118622304
1-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]triazole-4-carboxylic acid (PubChem CID 118622304) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]triazole-4-carboxylic acid.
| Compound Name | 1-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 118622304 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)Nc1ccn(CCCCn2cc(C(=O)O)nn2)c(=O)c1 |
| InChI | InChI=1S/C20H21N5O4/c26-18(12-15-6-2-1-3-7-15)21-16-8-11-24(19(27)13-16)9-4-5-10-25-14-17(20(28)29)22-23-25/h1-3,6-8,11,13-14H,4-5,9-10,12H2,(H,21,26)(H,28,29) |
| InChIKey | FYLKEBWIJCXCDJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|