C27H38N6O3 — CID 144993150
(Z)-2-amino-3-[amino-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]amino]-N-(cyclohexylmethyl)prop-2-enamide (PubChem CID 144993150) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]amino]-N-(cyclohexylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]amino]-N-(cyclohexylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 144993150 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-[2-oxo-4-[(2-phenylacetyl)amino]-1-pyridinyl]butyl]amino]-N-(cyclohexylmethyl)prop-2-enamide |
| SMILES | N/C(=C\N(N)CCCCn1ccc(NC(=O)Cc2ccccc2)cc1=O)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C27H38N6O3/c28-24(27(36)30-19-22-11-5-2-6-12-22)20-33(29)15-8-7-14-32-16-13-23(18-26(32)35)31-25(34)17-21-9-3-1-4-10-21/h1,3-4,9-10,13,16,18,20,22H,2,5-8,11-12,14-15,17,19,28-29H2,(H,30,36)(H,31,34)/b24-20- |
| InChIKey | DUVAAMZDNLLQSB-GFMRDNFCSA-N |
| XLogP | 2.48 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|