C23H29N3O3 — CID 56503994
2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxy-N-(cyclohexylmethyl)acetamide (PubChem CID 56503994) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxy-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxy-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 56503994 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxy-N-(cyclohexylmethyl)acetamide |
| SMILES | N/C(=N/OCC(=O)NCC1CCCCC1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O3/c24-23(26-29-17-22(27)25-15-18-9-3-1-4-10-18)20-13-7-8-14-21(20)28-16-19-11-5-2-6-12-19/h2,5-8,11-14,18H,1,3-4,9-10,15-17H2,(H2,24,26)(H,25,27) |
| InChIKey | MJDVGJGEFNTRIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|