C25H26N4O4 — CID 56502458
3-[[2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxyacetyl]amino]-N,N-dimethylbenzamide (PubChem CID 56502458) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-[[2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxyacetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxyacetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 56502458 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[[2-[(E)-[amino-(2-phenylmethoxyphenyl)methylidene]amino]oxyacetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)CO/N=C(/N)c2ccccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-29(2)25(31)19-11-8-12-20(15-19)27-23(30)17-33-28-24(26)21-13-6-7-14-22(21)32-16-18-9-4-3-5-10-18/h3-15H,16-17H2,1-2H3,(H2,26,28)(H,27,30) |
| InChIKey | RUSHBQRENWMALH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|