C27H29N3O4 — CID 95303208
N,N-dimethyl-4-[[2-[(E)-1-[4-[(3-methylphenyl)methoxy]phenyl]ethylideneamino]oxyacetyl]amino]benzamide (PubChem CID 95303208) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N,N-dimethyl-4-[[2-[(E)-1-[4-[(3-methylphenyl)methoxy]phenyl]ethylideneamino]oxyacetyl]amino]benzamide.
| Compound Name | N,N-dimethyl-4-[[2-[(E)-1-[4-[(3-methylphenyl)methoxy]phenyl]ethylideneamino]oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 95303208 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N,N-dimethyl-4-[[2-[(E)-1-[4-[(3-methylphenyl)methoxy]phenyl]ethylideneamino]oxyacetyl]amino]benzamide |
| SMILES | C/C(=N\OCC(=O)Nc1ccc(C(=O)N(C)C)cc1)c1ccc(OCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-19-6-5-7-21(16-19)17-33-25-14-10-22(11-15-25)20(2)29-34-18-26(31)28-24-12-8-23(9-13-24)27(32)30(3)4/h5-16H,17-18H2,1-4H3,(H,28,31)/b29-20+ |
| InChIKey | WEQVXUFWJBXWSW-ZTKZIYFRSA-N |
| XLogP | 4.66 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|