C25H33N3O2 — CID 56533856
N-[4-(cyclopentylmethylamino)phenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide (PubChem CID 56533856) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[4-(cyclopentylmethylamino)phenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide.
| Compound Name | N-[4-(cyclopentylmethylamino)phenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 56533856 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[4-(cyclopentylmethylamino)phenyl]-3-methyl-2-[(2-phenylacetyl)amino]butanamide |
| SMILES | CC(C)C(NC(=O)Cc1ccccc1)C(=O)Nc1ccc(NCC2CCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O2/c1-18(2)24(28-23(29)16-19-8-4-3-5-9-19)25(30)27-22-14-12-21(13-15-22)26-17-20-10-6-7-11-20/h3-5,8-9,12-15,18,20,24,26H,6-7,10-11,16-17H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | PQNDQPINJPMHOH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |