C21H25N3O7 — CID 155209916
[4-[(2S)-3-[methoxy(methyl)amino]-3-oxo-2-(phenylmethoxycarbonylamino)propoxy]phenyl]methylcarbamic acid (PubChem CID 155209916) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is [4-[(2S)-3-[methoxy(methyl)amino]-3-oxo-2-(phenylmethoxycarbonylamino)propoxy]phenyl]methylcarbamic acid.
| Compound Name | [4-[(2S)-3-[methoxy(methyl)amino]-3-oxo-2-(phenylmethoxycarbonylamino)propoxy]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 155209916 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [4-[(2S)-3-[methoxy(methyl)amino]-3-oxo-2-(phenylmethoxycarbonylamino)propoxy]phenyl]methylcarbamic acid |
| SMILES | CON(C)C(=O)[C@H](COc1ccc(CNC(=O)O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O7/c1-24(29-2)19(25)18(23-21(28)31-13-16-6-4-3-5-7-16)14-30-17-10-8-15(9-11-17)12-22-20(26)27/h3-11,18,22H,12-14H2,1-2H3,(H,23,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | BTHYTMMJORBAPN-SFHVURJKSA-N |
| XLogP | 2.15 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|