C28H40N4O7 — CID 162512536
benzyl N-[(2S)-1-[methoxy(methyl)amino]-3-[3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]phenoxy]-1-oxopropan-2-yl]carbamate (PubChem CID 162512536) has the molecular formula C28H40N4O7 and a molecular weight of 544.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[methoxy(methyl)amino]-3-[3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]phenoxy]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[methoxy(methyl)amino]-3-[3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]phenoxy]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 162512536 |
| Molecular Formula | C28H40N4O7 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | benzyl N-[(2S)-1-[methoxy(methyl)amino]-3-[3-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]methyl]phenoxy]-1-oxopropan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@H](COc1cccc(CNCCCNC(=O)OC(C)(C)C)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H40N4O7/c1-28(2,3)39-26(34)30-16-10-15-29-18-22-13-9-14-23(17-22)37-20-24(25(33)32(4)36-5)31-27(35)38-19-21-11-7-6-8-12-21/h6-9,11-14,17,24,29H,10,15-16,18-20H2,1-5H3,(H,30,34)(H,31,35)/t24-/m0/s1 |
| InChIKey | CCUIXKALJHLVOL-DEOSSOPVSA-N |
| XLogP | 3.38 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|