C26H26F3N7O4S — CID 155171261
N-[5-[4-[6-[[1-hydroxy-2-[3-hydroxy-5-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide (PubChem CID 155171261) has the molecular formula C26H26F3N7O4S and a molecular weight of 589.60 g/mol. Its IUPAC name is N-[5-[4-[6-[[1-hydroxy-2-[3-hydroxy-5-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[5-[4-[6-[[1-hydroxy-2-[3-hydroxy-5-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 155171261 |
| Molecular Formula | C26H26F3N7O4S |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | N-[5-[4-[6-[[1-hydroxy-2-[3-hydroxy-5-(trifluoromethoxy)phenyl]ethyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
| SMILES | O=C(Cc1ccccn1)Nc1nnc(CCCCc2ccc(NC(O)Cc3cc(O)cc(OC(F)(F)F)c3)nn2)s1 |
| InChI | InChI=1S/C26H26F3N7O4S/c27-26(28,29)40-20-12-16(11-19(37)15-20)13-22(38)31-21-9-8-17(33-34-21)5-1-2-7-24-35-36-25(41-24)32-23(39)14-18-6-3-4-10-30-18/h3-4,6,8-12,15,22,37-38H,1-2,5,7,13-14H2,(H,31,34)(H,32,36,39) |
| InChIKey | MHGQGBCDYVWCFE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|