C29H32N6O5S — CID 134302740
methyl 2-[3-[2-[[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethoxy]phenyl]acetate (PubChem CID 134302740) has the molecular formula C29H32N6O5S and a molecular weight of 576.68 g/mol. Its IUPAC name is methyl 2-[3-[2-[[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[2-[[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 134302740 |
| Molecular Formula | C29H32N6O5S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | methyl 2-[3-[2-[[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(OCC(=O)Nc2nnc(CCCCc3ccc(NC(O)Cc4ccccc4)nn3)s2)c1 |
| InChI | InChI=1S/C29H32N6O5S/c1-39-28(38)18-21-10-7-12-23(16-21)40-19-26(37)31-29-35-34-27(41-29)13-6-5-11-22-14-15-24(33-32-22)30-25(36)17-20-8-3-2-4-9-20/h2-4,7-10,12,14-16,25,36H,5-6,11,13,17-19H2,1H3,(H,30,33)(H,31,35,37) |
| InChIKey | UKNGUGQJKPMUCR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|