C31H37FN8O2S — CID 155261349
2-[4-fluoro-3-(piperazin-1-ylmethyl)phenyl]-N-[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 155261349) has the molecular formula C31H37FN8O2S and a molecular weight of 604.76 g/mol. Its IUPAC name is 2-[4-fluoro-3-(piperazin-1-ylmethyl)phenyl]-N-[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[4-fluoro-3-(piperazin-1-ylmethyl)phenyl]-N-[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 155261349 |
| Molecular Formula | C31H37FN8O2S |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 2-[4-fluoro-3-(piperazin-1-ylmethyl)phenyl]-N-[5-[4-[6-[(1-hydroxy-2-phenylethyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(F)c(CN2CCNCC2)c1)Nc1nnc(CCCCc2ccc(NC(O)Cc3ccccc3)nn2)s1 |
| InChI | InChI=1S/C31H37FN8O2S/c32-26-12-10-23(18-24(26)21-40-16-14-33-15-17-40)20-29(42)35-31-39-38-30(43-31)9-5-4-8-25-11-13-27(37-36-25)34-28(41)19-22-6-2-1-3-7-22/h1-3,6-7,10-13,18,28,33,41H,4-5,8-9,14-17,19-21H2,(H,34,37)(H,35,39,42) |
| InChIKey | GOUNWSIMMKYLOO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|