C25H29N7O2S — CID 144640994
N-[5-[(5Z,7E)-5,8-diamino-8-[(2-pyridin-2-ylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 144640994) has the molecular formula C25H29N7O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[(2-pyridin-2-ylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[(2-pyridin-2-ylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 144640994 |
| Molecular Formula | C25H29N7O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[(2-pyridin-2-ylacetyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1ccccn1)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C25H29N7O2S/c26-19(13-14-21(27)29-23(34)17-20-11-6-7-15-28-20)10-4-5-12-24-31-32-25(35-24)30-22(33)16-18-8-2-1-3-9-18/h1-3,6-9,11,13-15H,4-5,10,12,16-17,26-27H2,(H,29,34)(H,30,32,33)/b19-13-,21-14+ |
| InChIKey | ZJHJVDWMMMKIEQ-GRDMYJHDSA-N |
| XLogP | 2.83 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|