C27H31N7O2S — CID 146202105
N-[(1E,3Z)-1,4-diamino-5-[3-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]penta-1,3-dienyl]-2-phenylacetamide (PubChem CID 146202105) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-5-[3-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]penta-1,3-dienyl]-2-phenylacetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-5-[3-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]penta-1,3-dienyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 146202105 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-5-[3-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]penta-1,3-dienyl]-2-phenylacetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1ccccc1)CC1CCC(c2nnc(NC(=O)Cc3ccccn3)s2)C1 |
| InChI | InChI=1S/C27H31N7O2S/c28-21(11-12-23(29)31-24(35)16-18-6-2-1-3-7-18)15-19-9-10-20(14-19)26-33-34-27(37-26)32-25(36)17-22-8-4-5-13-30-22/h1-8,11-13,19-20H,9-10,14-17,28-29H2,(H,31,35)(H,32,34,36)/b21-11-,23-12+ |
| InChIKey | TXCHPNYPSMXICK-LRIFWWGWSA-N |
| XLogP | 3.39 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|