C27H33N7O2S — CID 139460852
cis-[N'-(2-pyridin-2-ylacetyl)carbamimidoyl] (1S,3R)-3-[(2Z,4E)-2,5-diamino-5-[(2-phenylacetyl)amino]penta-2,4-dienyl]cyclopentane-1-carboximidothioate (PubChem CID 139460852) has the molecular formula C27H33N7O2S and a molecular weight of 519.68 g/mol. Its IUPAC name is cis-[N'-(2-pyridin-2-ylacetyl)carbamimidoyl] (1S,3R)-3-[(2Z,4E)-2,5-diamino-5-[(2-phenylacetyl)amino]penta-2,4-dienyl]cyclopentane-1-carboximidothioate.
| Compound Name | cis-[N'-(2-pyridin-2-ylacetyl)carbamimidoyl] (1S,3R)-3-[(2Z,4E)-2,5-diamino-5-[(2-phenylacetyl)amino]penta-2,4-dienyl]cyclopentane-1-carboximidothioate |
|---|---|
| PubChem CID | 139460852 |
| Molecular Formula | C27H33N7O2S |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | cis-[N'-(2-pyridin-2-ylacetyl)carbamimidoyl] (1S,3R)-3-[(2Z,4E)-2,5-diamino-5-[(2-phenylacetyl)amino]penta-2,4-dienyl]cyclopentane-1-carboximidothioate |
| SMILES | [H]/N=C(\S/C(N)=N/C(=O)Cc1ccccn1)[C@H]1CC[C@@H](C/C(N)=C/C=C(\N)NC(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H33N7O2S/c28-21(11-12-23(29)33-24(35)16-18-6-2-1-3-7-18)15-19-9-10-20(14-19)26(30)37-27(31)34-25(36)17-22-8-4-5-13-32-22/h1-8,11-13,19-20,30H,9-10,14-17,28-29H2,(H,33,35)(H2,31,34,36)/b21-11-,23-12+,30-26-/t19-,20+/m1/s1 |
| InChIKey | IWWSVNGUJIXGDT-GTASWAIGSA-N |
| XLogP | 2.98 |
| TPSA | 173.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|