C27H29N7O2S — CID 146202118
[N'-(2-pyridin-2-ylacetyl)carbamimidoyl] 3-[[6-[(2-phenylacetyl)amino]pyridazin-3-yl]methyl]cyclopentane-1-carboximidothioate (PubChem CID 146202118) has the molecular formula C27H29N7O2S and a molecular weight of 515.64 g/mol. Its IUPAC name is [N'-(2-pyridin-2-ylacetyl)carbamimidoyl] 3-[[6-[(2-phenylacetyl)amino]pyridazin-3-yl]methyl]cyclopentane-1-carboximidothioate.
| Compound Name | [N'-(2-pyridin-2-ylacetyl)carbamimidoyl] 3-[[6-[(2-phenylacetyl)amino]pyridazin-3-yl]methyl]cyclopentane-1-carboximidothioate |
|---|---|
| PubChem CID | 146202118 |
| Molecular Formula | C27H29N7O2S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | [N'-(2-pyridin-2-ylacetyl)carbamimidoyl] 3-[[6-[(2-phenylacetyl)amino]pyridazin-3-yl]methyl]cyclopentane-1-carboximidothioate |
| SMILES | [H]/N=C(\S/C(N)=N/C(=O)Cc1ccccn1)C1CCC(Cc2ccc(NC(=O)Cc3ccccc3)nn2)C1 |
| InChI | InChI=1S/C27H29N7O2S/c28-26(37-27(29)32-25(36)17-21-8-4-5-13-30-21)20-10-9-19(14-20)15-22-11-12-23(34-33-22)31-24(35)16-18-6-2-1-3-7-18/h1-8,11-13,19-20,28H,9-10,14-17H2,(H2,29,32,36)(H,31,34,35)/b28-26- |
| InChIKey | KIAZZKNKXYXVTK-SGEDCAFJSA-N |
| XLogP | 3.81 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|